C24H19ClN4O2S — CID 108752423
N-[6-(4-chlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4-naphthalen-2-yloxybutanamide (PubChem CID 108752423) has the molecular formula C24H19ClN4O2S and a molecular weight of 462.96 g/mol. Its IUPAC name is N-[6-(4-chlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4-naphthalen-2-yloxybutanamide.
| Compound Name | N-[6-(4-chlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4-naphthalen-2-yloxybutanamide |
|---|---|
| PubChem CID | 108752423 |
| Molecular Formula | C24H19ClN4O2S |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | N-[6-(4-chlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4-naphthalen-2-yloxybutanamide |
| SMILES | O=C(CCCOc1ccc2ccccc2c1)Nc1nc2scc(-c3ccc(Cl)cc3)n2n1 |
| InChI | InChI=1S/C24H19ClN4O2S/c25-19-10-7-17(8-11-19)21-15-32-24-27-23(28-29(21)24)26-22(30)6-3-13-31-20-12-9-16-4-1-2-5-18(16)14-20/h1-2,4-5,7-12,14-15H,3,6,13H2,(H,26,28,30) |
| InChIKey | ANJXDZXRJJLXDH-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|