C23H22ClN5O2S — CID 108728436
N-[6-[[6-(4-chlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]amino]-6-oxohexyl]benzamide (PubChem CID 108728436) has the molecular formula C23H22ClN5O2S and a molecular weight of 467.98 g/mol. Its IUPAC name is N-[6-[[6-(4-chlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]amino]-6-oxohexyl]benzamide.
| Compound Name | N-[6-[[6-(4-chlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]amino]-6-oxohexyl]benzamide |
|---|---|
| PubChem CID | 108728436 |
| Molecular Formula | C23H22ClN5O2S |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | N-[6-[[6-(4-chlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]amino]-6-oxohexyl]benzamide |
| SMILES | O=C(CCCCCNC(=O)c1ccccc1)Nc1nc2scc(-c3ccc(Cl)cc3)n2n1 |
| InChI | InChI=1S/C23H22ClN5O2S/c24-18-12-10-16(11-13-18)19-15-32-23-27-22(28-29(19)23)26-20(30)9-5-2-6-14-25-21(31)17-7-3-1-4-8-17/h1,3-4,7-8,10-13,15H,2,5-6,9,14H2,(H,25,31)(H,26,28,30) |
| InChIKey | DFHIIIJEHSENIZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|