C22H20Cl2N4O2S — CID 108752424
4-(4-chloro-3,5-dimethylphenoxy)-N-[6-(4-chlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]butanamide (PubChem CID 108752424) has the molecular formula C22H20Cl2N4O2S and a molecular weight of 475.40 g/mol. Its IUPAC name is 4-(4-chloro-3,5-dimethylphenoxy)-N-[6-(4-chlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]butanamide.
| Compound Name | 4-(4-chloro-3,5-dimethylphenoxy)-N-[6-(4-chlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]butanamide |
|---|---|
| PubChem CID | 108752424 |
| Molecular Formula | C22H20Cl2N4O2S |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 4-(4-chloro-3,5-dimethylphenoxy)-N-[6-(4-chlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]butanamide |
| SMILES | Cc1cc(OCCCC(=O)Nc2nc3scc(-c4ccc(Cl)cc4)n3n2)cc(C)c1Cl |
| InChI | InChI=1S/C22H20Cl2N4O2S/c1-13-10-17(11-14(2)20(13)24)30-9-3-4-19(29)25-21-26-22-28(27-21)18(12-31-22)15-5-7-16(23)8-6-15/h5-8,10-12H,3-4,9H2,1-2H3,(H,25,27,29) |
| InChIKey | FJMHYEMCORPHIA-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|