C19H12Cl2N4O3S — CID 108728567
[4-[[6-(2,4-dichlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]carbamoyl]phenyl] acetate (PubChem CID 108728567) has the molecular formula C19H12Cl2N4O3S and a molecular weight of 447.30 g/mol. Its IUPAC name is [4-[[6-(2,4-dichlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]carbamoyl]phenyl] acetate.
| Compound Name | [4-[[6-(2,4-dichlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108728567 |
| Molecular Formula | C19H12Cl2N4O3S |
| Molecular Weight | 447.30 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | [4-[[6-(2,4-dichlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)Nc2nc3scc(-c4ccc(Cl)cc4Cl)n3n2)cc1 |
| InChI | InChI=1S/C19H12Cl2N4O3S/c1-10(26)28-13-5-2-11(3-6-13)17(27)22-18-23-19-25(24-18)16(9-29-19)14-7-4-12(20)8-15(14)21/h2-9H,1H3,(H,22,24,27) |
| InChIKey | UQVHMDNQBGCCGC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.30 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|