C17H8Cl3N5O3S — CID 108728603
2-chloro-N-[6-(2,4-dichlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-5-nitrobenzamide (PubChem CID 108728603) has the molecular formula C17H8Cl3N5O3S and a molecular weight of 468.71 g/mol. Its IUPAC name is 2-chloro-N-[6-(2,4-dichlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[6-(2,4-dichlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 108728603 |
| Molecular Formula | C17H8Cl3N5O3S |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 466.94 |
| IUPAC Name | 2-chloro-N-[6-(2,4-dichlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-5-nitrobenzamide |
| SMILES | O=C(Nc1nc2scc(-c3ccc(Cl)cc3Cl)n2n1)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C17H8Cl3N5O3S/c18-8-1-3-10(13(20)5-8)14-7-29-17-22-16(23-24(14)17)21-15(26)11-6-9(25(27)28)2-4-12(11)19/h1-7H,(H,21,23,26) |
| InChIKey | IRSBUMNERHVKNM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|