C19H13Cl2N5O5S — CID 108742367
N-[6-(2,5-dichlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 108742367) has the molecular formula C19H13Cl2N5O5S and a molecular weight of 494.32 g/mol. Its IUPAC name is N-[6-(2,5-dichlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4,5-dimethoxy-2-nitrobenzamide.
| Compound Name | N-[6-(2,5-dichlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4,5-dimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 108742367 |
| Molecular Formula | C19H13Cl2N5O5S |
| Molecular Weight | 494.32 g/mol |
| Exact Mass | 493.00 |
| IUPAC Name | N-[6-(2,5-dichlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)Nc2nc3scc(-c4cc(Cl)ccc4Cl)n3n2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H13Cl2N5O5S/c1-30-15-6-11(13(26(28)29)7-16(15)31-2)17(27)22-18-23-19-25(24-18)14(8-32-19)10-5-9(20)3-4-12(10)21/h3-8H,1-2H3,(H,22,24,27) |
| InChIKey | HULXQKQOCPYFMR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.32 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|