C18H13N5O4S — CID 108728735
N-[6-(2-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-nitrobenzamide (PubChem CID 108728735) has the molecular formula C18H13N5O4S and a molecular weight of 395.40 g/mol. Its IUPAC name is N-[6-(2-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-nitrobenzamide.
| Compound Name | N-[6-(2-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 108728735 |
| Molecular Formula | C18H13N5O4S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | N-[6-(2-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-nitrobenzamide |
| SMILES | COc1ccccc1-c1csc2nc(NC(=O)c3ccccc3[N+](=O)[O-])nn12 |
| InChI | InChI=1S/C18H13N5O4S/c1-27-15-9-5-3-6-11(15)14-10-28-18-20-17(21-22(14)18)19-16(24)12-7-2-4-8-13(12)23(25)26/h2-10H,1H3,(H,19,21,24) |
| InChIKey | QHPYQHZBAWTDIM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|