C17H14N6O5S2 — CID 108772503
4-[[6-(2-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]amino]-3-nitrobenzenesulfonamide (PubChem CID 108772503) has the molecular formula C17H14N6O5S2 and a molecular weight of 446.47 g/mol. Its IUPAC name is 4-[[6-(2-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]amino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[6-(2-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 108772503 |
| Molecular Formula | C17H14N6O5S2 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | 4-[[6-(2-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]amino]-3-nitrobenzenesulfonamide |
| SMILES | COc1ccccc1-c1csc2nc(Nc3ccc(S(N)(=O)=O)cc3[N+](=O)[O-])nn12 |
| InChI | InChI=1S/C17H14N6O5S2/c1-28-15-5-3-2-4-11(15)14-9-29-17-20-16(21-22(14)17)19-12-7-6-10(30(18,26)27)8-13(12)23(24)25/h2-9H,1H3,(H,19,21)(H2,18,26,27) |
| InChIKey | PHTQFSYLALUCLB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 154.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|