C22H20N6O5S — CID 108728721
N-[6-(2-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 108728721) has the molecular formula C22H20N6O5S and a molecular weight of 480.51 g/mol. Its IUPAC name is N-[6-(2-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[6-(2-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 108728721 |
| Molecular Formula | C22H20N6O5S |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | N-[6-(2-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | COc1ccccc1-c1csc2nc(NC(=O)c3ccc(N4CCOCC4)c([N+](=O)[O-])c3)nn12 |
| InChI | InChI=1S/C22H20N6O5S/c1-32-19-5-3-2-4-15(19)18-13-34-22-24-21(25-27(18)22)23-20(29)14-6-7-16(17(12-14)28(30)31)26-8-10-33-11-9-26/h2-7,12-13H,8-11H2,1H3,(H,23,25,29) |
| InChIKey | MDLJYPJGLDCBQQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 124.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|