C23H23BrN2O3 — CID 108799774
N-(4-bromo-2-methylphenyl)-2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexane-1-carboxamide (PubChem CID 108799774) has the molecular formula C23H23BrN2O3 and a molecular weight of 455.35 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexane-1-carboxamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 108799774 |
| Molecular Formula | C23H23BrN2O3 |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexane-1-carboxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)C1CCCCC1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H23BrN2O3/c1-14-12-16(24)10-11-20(14)25-21(27)17-7-3-2-6-15(17)13-26-22(28)18-8-4-5-9-19(18)23(26)29/h4-5,8-12,15,17H,2-3,6-7,13H2,1H3,(H,25,27) |
| InChIKey | DPRZBOGSVSMJSS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|