C22H21N3O5 — CID 108786821
2-[(1,3-dioxoisoindol-2-yl)methyl]-N-(4-nitrophenyl)cyclohexane-1-carboxamide (PubChem CID 108786821) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is 2-[(1,3-dioxoisoindol-2-yl)methyl]-N-(4-nitrophenyl)cyclohexane-1-carboxamide.
| Compound Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]-N-(4-nitrophenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 108786821 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]-N-(4-nitrophenyl)cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)C1CCCCC1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H21N3O5/c26-20(23-15-9-11-16(12-10-15)25(29)30)17-6-2-1-5-14(17)13-24-21(27)18-7-3-4-8-19(18)22(24)28/h3-4,7-12,14,17H,1-2,5-6,13H2,(H,23,26) |
| InChIKey | MTLMIVWGPGQUJO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|