C24H27N3O5S — CID 108786914
2-[(1,3-dioxoisoindol-2-yl)methyl]-N-[2-(4-sulfamoylphenyl)ethyl]cyclohexane-1-carboxamide (PubChem CID 108786914) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is 2-[(1,3-dioxoisoindol-2-yl)methyl]-N-[2-(4-sulfamoylphenyl)ethyl]cyclohexane-1-carboxamide.
| Compound Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]-N-[2-(4-sulfamoylphenyl)ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 108786914 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]-N-[2-(4-sulfamoylphenyl)ethyl]cyclohexane-1-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)C2CCCCC2CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C24H27N3O5S/c25-33(31,32)18-11-9-16(10-12-18)13-14-26-22(28)19-6-2-1-5-17(19)15-27-23(29)20-7-3-4-8-21(20)24(27)30/h3-4,7-12,17,19H,1-2,5-6,13-15H2,(H,26,28)(H2,25,31,32) |
| InChIKey | BQLDAPTZKVUQAS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|