C17H16N4O5S — CID 113201848
2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 113201848) has the molecular formula C17H16N4O5S and a molecular weight of 388.41 g/mol. Its IUPAC name is 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 113201848 |
| Molecular Formula | C17H16N4O5S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)CN2C(=O)c3cccnc3C2=O)cc1 |
| InChI | InChI=1S/C17H16N4O5S/c18-27(25,26)12-5-3-11(4-6-12)7-9-19-14(22)10-21-16(23)13-2-1-8-20-15(13)17(21)24/h1-6,8H,7,9-10H2,(H,19,22)(H2,18,25,26) |
| InChIKey | GVWIOVSRVQRYMS-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 139.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|