C15H10FN3O3 — CID 113201904
2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-(4-fluorophenyl)acetamide (PubChem CID 113201904) has the molecular formula C15H10FN3O3 and a molecular weight of 299.26 g/mol. Its IUPAC name is 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 113201904 |
| Molecular Formula | C15H10FN3O3 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)c2cccnc2C1=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C15H10FN3O3/c16-9-3-5-10(6-4-9)18-12(20)8-19-14(21)11-2-1-7-17-13(11)15(19)22/h1-7H,8H2,(H,18,20) |
| InChIKey | XTIJVXYSIBZUJI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|