C17H13N3O5 — CID 113201934
methyl 2-[[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetyl]amino]benzoate (PubChem CID 113201934) has the molecular formula C17H13N3O5 and a molecular weight of 339.31 g/mol. Its IUPAC name is methyl 2-[[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 113201934 |
| Molecular Formula | C17H13N3O5 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | methyl 2-[[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CN1C(=O)c2cccnc2C1=O |
| InChI | InChI=1S/C17H13N3O5/c1-25-17(24)10-5-2-3-7-12(10)19-13(21)9-20-15(22)11-6-4-8-18-14(11)16(20)23/h2-8H,9H2,1H3,(H,19,21) |
| InChIKey | HBJBZMFLZSZICP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|