C15H9F2N3O3 — CID 113201972
N-(2,6-difluorophenyl)-2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetamide (PubChem CID 113201972) has the molecular formula C15H9F2N3O3 and a molecular weight of 317.25 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetamide.
| Compound Name | N-(2,6-difluorophenyl)-2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetamide |
|---|---|
| PubChem CID | 113201972 |
| Molecular Formula | C15H9F2N3O3 |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2cccnc2C1=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C15H9F2N3O3/c16-9-4-1-5-10(17)13(9)19-11(21)7-20-14(22)8-3-2-6-18-12(8)15(20)23/h1-6H,7H2,(H,19,21) |
| InChIKey | VYGRGIQBTOHCFP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|