C11H10N2O4 — CID 15744738
ethyl 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetate (PubChem CID 15744738) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is ethyl 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetate.
| Compound Name | ethyl 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetate |
|---|---|
| PubChem CID | 15744738 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | ethyl 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetate |
| SMILES | CCOC(=O)CN1C(=O)c2cccnc2C1=O |
| InChI | InChI=1S/C11H10N2O4/c1-2-17-8(14)6-13-10(15)7-4-3-5-12-9(7)11(13)16/h3-5H,2,6H2,1H3 |
| InChIKey | MVKZRHYHUMVGEY-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|