About ethyl 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetate
ethyl 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetate (PubChem CID 15744738) has the molecular formula C11H10N2O4
and a molecular weight of 234.21 g/mol. Its IUPAC name is ethyl 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetate |
| PubChem CID | 15744738 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | ethyl 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetate |
| SMILES | CCOC(=O)CN1C(=O)c2cccnc2C1=O |
| InChI | InChI=1S/C11H10N2O4/c1-2-17-8(14)6-13-10(15)7-4-3-5-12-9(7)11(13)16/h3-5H,2,6H2,1H3 |
| InChIKey | MVKZRHYHUMVGEY-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetate?
The IUPAC name of ethyl 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetate (CID 15744738) is ethyl 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetate.
What is the SMILES notation for ethyl 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetate?
The canonical SMILES for ethyl 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetate is CCOC(=O)CN1C(=O)c2cccnc2C1=O.
What is the InChIKey of ethyl 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetate?
The InChIKey is MVKZRHYHUMVGEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O4/c1-2-17-8(14)6-13-10(15)7-4-3-5-12-9(7)11(13)16/h3-5H,2,6H2,1H3.
What are the key properties of ethyl 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetate?
ethyl 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetate has a molecular weight of 234.21 g/mol, XLogP of 0.24, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)acetate is sourced from PubChem (CID 15744738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).