C20H20N4O3 — CID 113201855
6-[2-[4-(3-methylphenyl)piperazin-1-yl]-2-oxoethyl]pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 113201855) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 6-[2-[4-(3-methylphenyl)piperazin-1-yl]-2-oxoethyl]pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-[2-[4-(3-methylphenyl)piperazin-1-yl]-2-oxoethyl]pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 113201855 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 6-[2-[4-(3-methylphenyl)piperazin-1-yl]-2-oxoethyl]pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | Cc1cccc(N2CCN(C(=O)CN3C(=O)c4cccnc4C3=O)CC2)c1 |
| InChI | InChI=1S/C20H20N4O3/c1-14-4-2-5-15(12-14)22-8-10-23(11-9-22)17(25)13-24-19(26)16-6-3-7-21-18(16)20(24)27/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | DEEDYHKVFDENTC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|