C15H15NO5 — CID 10924265
ethyl 5-(1,3-dioxoisoindol-2-yl)-4-oxo(513C)pentanoate (PubChem CID 10924265) has the molecular formula C15H15NO5 and a molecular weight of 291.27 g/mol. Its IUPAC name is ethyl 5-(1,3-dioxoisoindol-2-yl)-4-oxo(513C)pentanoate.
| Compound Name | ethyl 5-(1,3-dioxoisoindol-2-yl)-4-oxo(513C)pentanoate |
|---|---|
| PubChem CID | 10924265 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | ethyl 5-(1,3-dioxoisoindol-2-yl)-4-oxo(513C)pentanoate |
| SMILES | CCOC(=O)CCC(=O)[13CH2][15N]1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H15NO5/c1-2-21-13(18)8-7-10(17)9-16-14(19)11-5-3-4-6-12(11)15(16)20/h3-6H,2,7-9H2,1H3/i9+1,16+1 |
| InChIKey | DSMRLLZTFBZEAN-QZZXWHIHSA-N |
| XLogP | 1.20 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|