C18H23NO5 — CID 170886181
ethyl 8-(1,3-dioxoisoindol-2-yl)-6-hydroxyoctanoate (PubChem CID 170886181) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is ethyl 8-(1,3-dioxoisoindol-2-yl)-6-hydroxyoctanoate.
| Compound Name | ethyl 8-(1,3-dioxoisoindol-2-yl)-6-hydroxyoctanoate |
|---|---|
| PubChem CID | 170886181 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | ethyl 8-(1,3-dioxoisoindol-2-yl)-6-hydroxyoctanoate |
| SMILES | CCOC(=O)CCCCC(O)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H23NO5/c1-2-24-16(21)10-6-3-7-13(20)11-12-19-17(22)14-8-4-5-9-15(14)18(19)23/h4-5,8-9,13,20H,2-3,6-7,10-12H2,1H3 |
| InChIKey | KIQMTIGIGOEJLT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|