C25H36N3O9P — CID 124528032
diethyl (2S)-2-[[[(1R)-1-[5-(1,3-dioxoisoindol-2-yl)pentanoylamino]ethyl]-methoxyphosphoryl]amino]pentanedioate (PubChem CID 124528032) has the molecular formula C25H36N3O9P and a molecular weight of 553.55 g/mol. Its IUPAC name is diethyl (2S)-2-[[[(1R)-1-[5-(1,3-dioxoisoindol-2-yl)pentanoylamino]ethyl]-methoxyphosphoryl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[[(1R)-1-[5-(1,3-dioxoisoindol-2-yl)pentanoylamino]ethyl]-methoxyphosphoryl]amino]pentanedioate |
|---|---|
| PubChem CID | 124528032 |
| Molecular Formula | C25H36N3O9P |
| Molecular Weight | 553.55 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | diethyl (2S)-2-[[[(1R)-1-[5-(1,3-dioxoisoindol-2-yl)pentanoylamino]ethyl]-methoxyphosphoryl]amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@H](N[P@@](=O)(OC)[C@H](C)NC(=O)CCCCN1C(=O)c2ccccc2C1=O)C(=O)OCC |
| InChI | InChI=1S/C25H36N3O9P/c1-5-36-22(30)15-14-20(25(33)37-6-2)27-38(34,35-4)17(3)26-21(29)13-9-10-16-28-23(31)18-11-7-8-12-19(18)24(28)32/h7-8,11-12,17,20H,5-6,9-10,13-16H2,1-4H3,(H,26,29)(H,27,34)/t17-,20+,38+/m1/s1 |
| InChIKey | QLPMYTASQFPPNX-RWUUWUGOSA-N |
| XLogP | 2.62 |
| TPSA | 157.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.55 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|