C25H27N3O7 — CID 40624572
diethyl (2S)-2-[[4-[(1,3-dioxoisoindol-2-yl)methylamino]benzoyl]amino]pentanedioate (PubChem CID 40624572) has the molecular formula C25H27N3O7 and a molecular weight of 481.51 g/mol. Its IUPAC name is diethyl (2S)-2-[[4-[(1,3-dioxoisoindol-2-yl)methylamino]benzoyl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[4-[(1,3-dioxoisoindol-2-yl)methylamino]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 40624572 |
| Molecular Formula | C25H27N3O7 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | diethyl (2S)-2-[[4-[(1,3-dioxoisoindol-2-yl)methylamino]benzoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@H](NC(=O)c1ccc(NCN2C(=O)c3ccccc3C2=O)cc1)C(=O)OCC |
| InChI | InChI=1S/C25H27N3O7/c1-3-34-21(29)14-13-20(25(33)35-4-2)27-22(30)16-9-11-17(12-10-16)26-15-28-23(31)18-7-5-6-8-19(18)24(28)32/h5-12,20,26H,3-4,13-15H2,1-2H3,(H,27,30)/t20-/m0/s1 |
| InChIKey | XTPJBWUTBKKSGH-FQEVSTJZSA-N |
| XLogP | 2.36 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|