C18H25FN2O5 — CID 12919922
diethyl (2S)-2-[[4-(2-fluoroethylamino)benzoyl]amino]pentanedioate (PubChem CID 12919922) has the molecular formula C18H25FN2O5 and a molecular weight of 368.41 g/mol. Its IUPAC name is diethyl (2S)-2-[[4-(2-fluoroethylamino)benzoyl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[4-(2-fluoroethylamino)benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 12919922 |
| Molecular Formula | C18H25FN2O5 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | diethyl (2S)-2-[[4-(2-fluoroethylamino)benzoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@H](NC(=O)c1ccc(NCCF)cc1)C(=O)OCC |
| InChI | InChI=1S/C18H25FN2O5/c1-3-25-16(22)10-9-15(18(24)26-4-2)21-17(23)13-5-7-14(8-6-13)20-12-11-19/h5-8,15,20H,3-4,9-12H2,1-2H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | FPANFOLHILSGFE-HNNXBMFYSA-N |
| XLogP | 2.07 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |