C20H28N2O7 — CID 67876954
diethyl (2S)-2-[[4-[ethoxycarbonyl(methyl)amino]benzoyl]amino]pentanedioate (PubChem CID 67876954) has the molecular formula C20H28N2O7 and a molecular weight of 408.45 g/mol. Its IUPAC name is diethyl (2S)-2-[[4-[ethoxycarbonyl(methyl)amino]benzoyl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[4-[ethoxycarbonyl(methyl)amino]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 67876954 |
| Molecular Formula | C20H28N2O7 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | diethyl (2S)-2-[[4-[ethoxycarbonyl(methyl)amino]benzoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@H](NC(=O)c1ccc(N(C)C(=O)OCC)cc1)C(=O)OCC |
| InChI | InChI=1S/C20H28N2O7/c1-5-27-17(23)13-12-16(19(25)28-6-2)21-18(24)14-8-10-15(11-9-14)22(4)20(26)29-7-3/h8-11,16H,5-7,12-13H2,1-4H3,(H,21,24)/t16-/m0/s1 |
| InChIKey | IKWDJAKDNVSZNC-INIZCTEOSA-N |
| XLogP | 2.28 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|