C19H24N2O7 — CID 18369952
diethyl 2-[[4-(2,3-dihydroxyprop-1-enylideneamino)benzoyl]amino]pentanedioate (PubChem CID 18369952) has the molecular formula C19H24N2O7 and a molecular weight of 392.41 g/mol. Its IUPAC name is diethyl 2-[[4-(2,3-dihydroxyprop-1-enylideneamino)benzoyl]amino]pentanedioate.
| Compound Name | diethyl 2-[[4-(2,3-dihydroxyprop-1-enylideneamino)benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 18369952 |
| Molecular Formula | C19H24N2O7 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | diethyl 2-[[4-(2,3-dihydroxyprop-1-enylideneamino)benzoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CCC(NC(=O)c1ccc(N=C=C(O)CO)cc1)C(=O)OCC |
| InChI | InChI=1S/C19H24N2O7/c1-3-27-17(24)10-9-16(19(26)28-4-2)21-18(25)13-5-7-14(8-6-13)20-11-15(23)12-22/h5-8,16,22-23H,3-4,9-10,12H2,1-2H3,(H,21,25) |
| InChIKey | YOCRIBQTMWBSOR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|