C17H24N2O6 — CID 67926864
diethyl (2R)-2-[(4-amino-3-methoxybenzoyl)amino]pentanedioate (PubChem CID 67926864) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is diethyl (2R)-2-[(4-amino-3-methoxybenzoyl)amino]pentanedioate.
| Compound Name | diethyl (2R)-2-[(4-amino-3-methoxybenzoyl)amino]pentanedioate |
|---|---|
| PubChem CID | 67926864 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | diethyl (2R)-2-[(4-amino-3-methoxybenzoyl)amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@@H](NC(=O)c1ccc(N)c(OC)c1)C(=O)OCC |
| InChI | InChI=1S/C17H24N2O6/c1-4-24-15(20)9-8-13(17(22)25-5-2)19-16(21)11-6-7-12(18)14(10-11)23-3/h6-7,10,13H,4-5,8-9,18H2,1-3H3,(H,19,21)/t13-/m1/s1 |
| InChIKey | SNNXSTPNJNKBGZ-CYBMUJFWSA-N |
| XLogP | 1.28 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|