C24H28N2O6 — CID 3495215
diethyl 2-[[4-[(4-methylbenzoyl)amino]benzoyl]amino]pentanedioate (PubChem CID 3495215) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is diethyl 2-[[4-[(4-methylbenzoyl)amino]benzoyl]amino]pentanedioate.
| Compound Name | diethyl 2-[[4-[(4-methylbenzoyl)amino]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 3495215 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | diethyl 2-[[4-[(4-methylbenzoyl)amino]benzoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CCC(NC(=O)c1ccc(NC(=O)c2ccc(C)cc2)cc1)C(=O)OCC |
| InChI | InChI=1S/C24H28N2O6/c1-4-31-21(27)15-14-20(24(30)32-5-2)26-23(29)18-10-12-19(13-11-18)25-22(28)17-8-6-16(3)7-9-17/h6-13,20H,4-5,14-15H2,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | AWLLYGFAEWFSBF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |