C19H29N3O5S — CID 10070216
diethyl (2S)-2-[[4-[(3-amino-2-sulfanylpropyl)amino]benzoyl]amino]pentanedioate (PubChem CID 10070216) has the molecular formula C19H29N3O5S and a molecular weight of 411.52 g/mol. Its IUPAC name is diethyl (2S)-2-[[4-[(3-amino-2-sulfanylpropyl)amino]benzoyl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[4-[(3-amino-2-sulfanylpropyl)amino]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 10070216 |
| Molecular Formula | C19H29N3O5S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | diethyl (2S)-2-[[4-[(3-amino-2-sulfanylpropyl)amino]benzoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@H](NC(=O)c1ccc(NCC(S)CN)cc1)C(=O)OCC |
| InChI | InChI=1S/C19H29N3O5S/c1-3-26-17(23)10-9-16(19(25)27-4-2)22-18(24)13-5-7-14(8-6-13)21-12-15(28)11-20/h5-8,15-16,21,28H,3-4,9-12,20H2,1-2H3,(H,22,24)/t15?,16-/m0/s1 |
| InChIKey | YVNKEJJQHHOMMV-LYKKTTPLSA-N |
| XLogP | 1.36 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|