C19H26N2O5 — CID 12919868
diethyl (2S)-2-[[4-(prop-2-enylamino)benzoyl]amino]pentanedioate (PubChem CID 12919868) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is diethyl (2S)-2-[[4-(prop-2-enylamino)benzoyl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[4-(prop-2-enylamino)benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 12919868 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | diethyl (2S)-2-[[4-(prop-2-enylamino)benzoyl]amino]pentanedioate |
| SMILES | C=CCNc1ccc(C(=O)N[C@@H](CCC(=O)OCC)C(=O)OCC)cc1 |
| InChI | InChI=1S/C19H26N2O5/c1-4-13-20-15-9-7-14(8-10-15)18(23)21-16(19(24)26-6-3)11-12-17(22)25-5-2/h4,7-10,16,20H,1,5-6,11-13H2,2-3H3,(H,21,23)/t16-/m0/s1 |
| InChIKey | LTDDFVULHCTJTI-INIZCTEOSA-N |
| XLogP | 2.29 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|