C17H23N3O6 — CID 171379925
diethyl (2S)-2-[[4-[methyl(nitroso)amino]benzoyl]amino]pentanedioate (PubChem CID 171379925) has the molecular formula C17H23N3O6 and a molecular weight of 365.39 g/mol. Its IUPAC name is diethyl (2S)-2-[[4-[methyl(nitroso)amino]benzoyl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[4-[methyl(nitroso)amino]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 171379925 |
| Molecular Formula | C17H23N3O6 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | diethyl (2S)-2-[[4-[methyl(nitroso)amino]benzoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@H](NC(=O)c1ccc(N(C)N=O)cc1)C(=O)OCC |
| InChI | InChI=1S/C17H23N3O6/c1-4-25-15(21)11-10-14(17(23)26-5-2)18-16(22)12-6-8-13(9-7-12)20(3)19-24/h6-9,14H,4-5,10-11H2,1-3H3,(H,18,22)/t14-/m0/s1 |
| InChIKey | SGJGJGGDPXINMI-AWEZNQCLSA-N |
| XLogP | 1.81 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|