C18H24N2O6 — CID 71333622
diethyl 2-[[4-(2-oxoethylamino)benzoyl]amino]pentanedioate (PubChem CID 71333622) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is diethyl 2-[[4-(2-oxoethylamino)benzoyl]amino]pentanedioate.
| Compound Name | diethyl 2-[[4-(2-oxoethylamino)benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 71333622 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | diethyl 2-[[4-(2-oxoethylamino)benzoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CCC(NC(=O)c1ccc(NCC=O)cc1)C(=O)OCC |
| InChI | InChI=1S/C18H24N2O6/c1-3-25-16(22)10-9-15(18(24)26-4-2)20-17(23)13-5-7-14(8-6-13)19-11-12-21/h5-8,12,15,19H,3-4,9-11H2,1-2H3,(H,20,23) |
| InChIKey | NCOOINFFNSRNBX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|