C15H19BrN2O5 — CID 123619721
diethyl 2-[(6-bromopyridine-3-carbonyl)amino]pentanedioate (PubChem CID 123619721) has the molecular formula C15H19BrN2O5 and a molecular weight of 387.23 g/mol. Its IUPAC name is diethyl 2-[(6-bromopyridine-3-carbonyl)amino]pentanedioate.
| Compound Name | diethyl 2-[(6-bromopyridine-3-carbonyl)amino]pentanedioate |
|---|---|
| PubChem CID | 123619721 |
| Molecular Formula | C15H19BrN2O5 |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | diethyl 2-[(6-bromopyridine-3-carbonyl)amino]pentanedioate |
| SMILES | CCOC(=O)CCC(NC(=O)c1ccc(Br)nc1)C(=O)OCC |
| InChI | InChI=1S/C15H19BrN2O5/c1-3-22-13(19)8-6-11(15(21)23-4-2)18-14(20)10-5-7-12(16)17-9-10/h5,7,9,11H,3-4,6,8H2,1-2H3,(H,18,20) |
| InChIKey | DHNPQNSRKMJJJH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|