C13H17BrN2O5S — CID 70110304
diethyl (2R)-2-[(2-bromo-1,3-thiazole-4-carbonyl)amino]pentanedioate (PubChem CID 70110304) has the molecular formula C13H17BrN2O5S and a molecular weight of 393.26 g/mol. Its IUPAC name is diethyl (2R)-2-[(2-bromo-1,3-thiazole-4-carbonyl)amino]pentanedioate.
| Compound Name | diethyl (2R)-2-[(2-bromo-1,3-thiazole-4-carbonyl)amino]pentanedioate |
|---|---|
| PubChem CID | 70110304 |
| Molecular Formula | C13H17BrN2O5S |
| Molecular Weight | 393.26 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | diethyl (2R)-2-[(2-bromo-1,3-thiazole-4-carbonyl)amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@@H](NC(=O)c1csc(Br)n1)C(=O)OCC |
| InChI | InChI=1S/C13H17BrN2O5S/c1-3-20-10(17)6-5-8(12(19)21-4-2)15-11(18)9-7-22-13(14)16-9/h7-8H,3-6H2,1-2H3,(H,15,18)/t8-/m1/s1 |
| InChIKey | QFCBKMUNVKZVBR-MRVPVSSYSA-N |
| XLogP | 1.91 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |