About diethyl 2-[(2-piperidin-4-yl-1,3-oxazole-4-carbonyl)amino]pentanedioate
diethyl 2-[(2-piperidin-4-yl-1,3-oxazole-4-carbonyl)amino]pentanedioate (PubChem CID 3852120) has the molecular formula C18H27N3O6
and a molecular weight of 381.43 g/mol. Its IUPAC name is diethyl 2-[(2-piperidin-4-yl-1,3-oxazole-4-carbonyl)amino]pentanedioate.
Molecular Properties
| Compound Name | diethyl 2-[(2-piperidin-4-yl-1,3-oxazole-4-carbonyl)amino]pentanedioate |
| PubChem CID | 3852120 |
| Molecular Formula | C18H27N3O6 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | diethyl 2-[(2-piperidin-4-yl-1,3-oxazole-4-carbonyl)amino]pentanedioate |
| SMILES | CCOC(=O)CCC(NC(=O)c1coc(C2CCNCC2)n1)C(=O)OCC |
| InChI | InChI=1S/C18H27N3O6/c1-3-25-15(22)6-5-13(18(24)26-4-2)20-16(23)14-11-27-17(21-14)12-7-9-19-10-8-12/h11-13,19H,3-10H2,1-2H3,(H,20,23) |
| InChIKey | UPAZNZLZHDDQMU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 119.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze diethyl 2-[(2-piperidin-4-yl-1,3-oxazole-4-carbonyl)amino]pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[(2-piperidin-4-yl-1,3-oxazole-4-carbonyl)amino]pentanedioate?
The IUPAC name of diethyl 2-[(2-piperidin-4-yl-1,3-oxazole-4-carbonyl)amino]pentanedioate (CID 3852120) is diethyl 2-[(2-piperidin-4-yl-1,3-oxazole-4-carbonyl)amino]pentanedioate.
What is the SMILES notation for diethyl 2-[(2-piperidin-4-yl-1,3-oxazole-4-carbonyl)amino]pentanedioate?
The canonical SMILES for diethyl 2-[(2-piperidin-4-yl-1,3-oxazole-4-carbonyl)amino]pentanedioate is CCOC(=O)CCC(NC(=O)c1coc(C2CCNCC2)n1)C(=O)OCC.
What is the InChIKey of diethyl 2-[(2-piperidin-4-yl-1,3-oxazole-4-carbonyl)amino]pentanedioate?
The InChIKey is UPAZNZLZHDDQMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3O6/c1-3-25-15(22)6-5-13(18(24)26-4-2)20-16(23)14-11-27-17(21-14)12-7-9-19-10-8-12/h11-13,19H,3-10H2,1-2H3,(H,20,23).
What are the key properties of diethyl 2-[(2-piperidin-4-yl-1,3-oxazole-4-carbonyl)amino]pentanedioate?
diethyl 2-[(2-piperidin-4-yl-1,3-oxazole-4-carbonyl)amino]pentanedioate has a molecular weight of 381.43 g/mol, XLogP of 1.15, 9 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[(2-piperidin-4-yl-1,3-oxazole-4-carbonyl)amino]pentanedioate is sourced from PubChem (CID 3852120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).