C16H26N6O4 — CID 4987379
ethyl 5-(diaminomethylideneamino)-2-[(2-pyrrolidin-2-yl-1,3-oxazole-4-carbonyl)amino]pentanoate (PubChem CID 4987379) has the molecular formula C16H26N6O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is ethyl 5-(diaminomethylideneamino)-2-[(2-pyrrolidin-2-yl-1,3-oxazole-4-carbonyl)amino]pentanoate.
| Compound Name | ethyl 5-(diaminomethylideneamino)-2-[(2-pyrrolidin-2-yl-1,3-oxazole-4-carbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 4987379 |
| Molecular Formula | C16H26N6O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | ethyl 5-(diaminomethylideneamino)-2-[(2-pyrrolidin-2-yl-1,3-oxazole-4-carbonyl)amino]pentanoate |
| SMILES | CCOC(=O)C(CCCN=C(N)N)NC(=O)c1coc(C2CCCN2)n1 |
| InChI | InChI=1S/C16H26N6O4/c1-2-25-15(24)11(6-4-8-20-16(17)18)21-13(23)12-9-26-14(22-12)10-5-3-7-19-10/h9-11,19H,2-8H2,1H3,(H,21,23)(H4,17,18,20) |
| InChIKey | FEGOPRULHIJTBH-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 157.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|