C29H34N6O6 — CID 138747422
(2S)-2-[[2-[(2S)-1-[(4-benzoylbenzoyl)amino]-2-methylbutyl]-1,3-oxazole-4-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 138747422) has the molecular formula C29H34N6O6 and a molecular weight of 562.63 g/mol. Its IUPAC name is (2S)-2-[[2-[(2S)-1-[(4-benzoylbenzoyl)amino]-2-methylbutyl]-1,3-oxazole-4-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[2-[(2S)-1-[(4-benzoylbenzoyl)amino]-2-methylbutyl]-1,3-oxazole-4-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 138747422 |
| Molecular Formula | C29H34N6O6 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | (2S)-2-[[2-[(2S)-1-[(4-benzoylbenzoyl)amino]-2-methylbutyl]-1,3-oxazole-4-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC[C@H](C)C(NC(=O)c1ccc(C(=O)c2ccccc2)cc1)c1nc(C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)co1 |
| InChI | InChI=1S/C29H34N6O6/c1-3-17(2)23(35-25(37)20-13-11-19(12-14-20)24(36)18-8-5-4-6-9-18)27-34-22(16-41-27)26(38)33-21(28(39)40)10-7-15-32-29(30)31/h4-6,8-9,11-14,16-17,21,23H,3,7,10,15H2,1-2H3,(H,33,38)(H,35,37)(H,39,40)(H4,30,31,32)/t17-,21-,23?/m0/s1 |
| InChIKey | QAEFCKZEIVCTGO-AFCKPWEZSA-N |
| XLogP | 2.66 |
| TPSA | 203.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|