C25H32N6O5 — CID 126651899
(2S)-5-(1-aminoethylideneamino)-2-[[2-[(1S)-1-(1H-indole-3-carbonylamino)-3-methylbutyl]-1,3-oxazole-4-carbonyl]amino]pentanoic acid (PubChem CID 126651899) has the molecular formula C25H32N6O5 and a molecular weight of 496.57 g/mol. Its IUPAC name is (2S)-5-(1-aminoethylideneamino)-2-[[2-[(1S)-1-(1H-indole-3-carbonylamino)-3-methylbutyl]-1,3-oxazole-4-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(1-aminoethylideneamino)-2-[[2-[(1S)-1-(1H-indole-3-carbonylamino)-3-methylbutyl]-1,3-oxazole-4-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 126651899 |
| Molecular Formula | C25H32N6O5 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | (2S)-5-(1-aminoethylideneamino)-2-[[2-[(1S)-1-(1H-indole-3-carbonylamino)-3-methylbutyl]-1,3-oxazole-4-carbonyl]amino]pentanoic acid |
| SMILES | C/C(N)=N\CCC[C@H](NC(=O)c1coc([C@H](CC(C)C)NC(=O)c2c[nH]c3ccccc23)n1)C(=O)O |
| InChI | InChI=1S/C25H32N6O5/c1-14(2)11-20(30-22(32)17-12-28-18-8-5-4-7-16(17)18)24-31-21(13-36-24)23(33)29-19(25(34)35)9-6-10-27-15(3)26/h4-5,7-8,12-14,19-20,28H,6,9-11H2,1-3H3,(H2,26,27)(H,29,33)(H,30,32)(H,34,35)/t19-,20-/m0/s1 |
| InChIKey | YSOQICIVQTZBFK-PMACEKPBSA-N |
| XLogP | 3.01 |
| TPSA | 175.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|