C18H20F3N5O6 — CID 42639669
(2R)-5-(diaminomethylideneamino)-2-[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]pentanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 42639669) has the molecular formula C18H20F3N5O6 and a molecular weight of 459.38 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]pentanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]pentanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 42639669 |
| Molecular Formula | C18H20F3N5O6 |
| Molecular Weight | 459.38 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]pentanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | NC(N)=NCCC[C@@H](NC(=O)C(=O)c1c[nH]c2ccccc12)C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H19N5O4.C2HF3O2/c17-16(18)19-7-3-6-12(15(24)25)21-14(23)13(22)10-8-20-11-5-2-1-4-9(10)11;3-2(4,5)1(6)7/h1-2,4-5,8,12,20H,3,6-7H2,(H,21,23)(H,24,25)(H4,17,18,19);(H,6,7)/t12-;/m1./s1 |
| InChIKey | OLFLHQUGLQKVLA-UTONKHPSSA-N |
| XLogP | 0.61 |
| TPSA | 200.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.38 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|