C16H19N5O5 — CID 42639668
(2S)-5-(diaminomethylideneamino)-2-[[2-(6-hydroxy-1H-indol-3-yl)-2-oxoacetyl]amino]pentanoic acid (PubChem CID 42639668) has the molecular formula C16H19N5O5 and a molecular weight of 361.36 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[2-(6-hydroxy-1H-indol-3-yl)-2-oxoacetyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[2-(6-hydroxy-1H-indol-3-yl)-2-oxoacetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 42639668 |
| Molecular Formula | C16H19N5O5 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[2-(6-hydroxy-1H-indol-3-yl)-2-oxoacetyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)C(=O)c1c[nH]c2cc(O)ccc12)C(=O)O |
| InChI | InChI=1S/C16H19N5O5/c17-16(18)19-5-1-2-11(15(25)26)21-14(24)13(23)10-7-20-12-6-8(22)3-4-9(10)12/h3-4,6-7,11,20,22H,1-2,5H2,(H,21,24)(H,25,26)(H4,17,18,19)/t11-/m0/s1 |
| InChIKey | QVSCVARRYSXBKH-NSHDSACASA-N |
| XLogP | -0.32 |
| TPSA | 183.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|