C28H36N8O5 — CID 18490189
2-[[2-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18490189) has the molecular formula C28H36N8O5 and a molecular weight of 564.65 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18490189 |
| Molecular Formula | C28H36N8O5 |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NCC(=O)NC(Cc1ccccc1)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C28H36N8O5/c29-15-24(37)34-22(13-17-7-2-1-3-8-17)25(38)36-23(14-18-16-33-20-10-5-4-9-19(18)20)26(39)35-21(27(40)41)11-6-12-32-28(30)31/h1-5,7-10,16,21-23,33H,6,11-15,29H2,(H,34,37)(H,35,39)(H,36,38)(H,40,41)(H4,30,31,32) |
| InChIKey | GFIHLBXOWMTWLF-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 230.81 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|