C23H32N8O7 — CID 18485218
3-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutanoic acid (PubChem CID 18485218) has the molecular formula C23H32N8O7 and a molecular weight of 532.56 g/mol. Its IUPAC name is 3-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18485218 |
| Molecular Formula | C23H32N8O7 |
| Molecular Weight | 532.56 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 3-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutanoic acid |
| SMILES | NCC(=O)NC(CCCN=C(N)N)C(=O)NC(CC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C23H32N8O7/c24-10-18(32)29-15(6-3-7-27-23(25)26)20(35)30-16(9-19(33)34)21(36)31-17(22(37)38)8-12-11-28-14-5-2-1-4-13(12)14/h1-2,4-5,11,15-17,28H,3,6-10,24H2,(H,29,32)(H,30,35)(H,31,36)(H,33,34)(H,37,38)(H4,25,26,27) |
| InChIKey | KRJADNCGSRDQKL-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 268.11 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.56 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|