C22H21FN4O6 — CID 6851122
(2S)-5-(diaminomethylideneamino)-2-[[3-(4-fluorophenyl)-7-hydroxy-4-oxochromene-2-carbonyl]amino]pentanoic acid (PubChem CID 6851122) has the molecular formula C22H21FN4O6 and a molecular weight of 456.43 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[3-(4-fluorophenyl)-7-hydroxy-4-oxochromene-2-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[3-(4-fluorophenyl)-7-hydroxy-4-oxochromene-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 6851122 |
| Molecular Formula | C22H21FN4O6 |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[3-(4-fluorophenyl)-7-hydroxy-4-oxochromene-2-carbonyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)c1oc2cc(O)ccc2c(=O)c1-c1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C22H21FN4O6/c23-12-5-3-11(4-6-12)17-18(29)14-8-7-13(28)10-16(14)33-19(17)20(30)27-15(21(31)32)2-1-9-26-22(24)25/h3-8,10,15,28H,1-2,9H2,(H,27,30)(H,31,32)(H4,24,25,26)/t15-/m0/s1 |
| InChIKey | IGUYXYURIISSQA-HNNXBMFYSA-N |
| XLogP | 1.54 |
| TPSA | 181.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|