C31H40FN5O4 — CID 89219295
(2S)-5-(diaminomethylideneamino)-2-[[(4R,6R,7E)-8-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-4,6-dihydroxyocta-1,7-dien-2-yl]amino]pentanoic acid (PubChem CID 89219295) has the molecular formula C31H40FN5O4 and a molecular weight of 565.69 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[(4R,6R,7E)-8-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-4,6-dihydroxyocta-1,7-dien-2-yl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[(4R,6R,7E)-8-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-4,6-dihydroxyocta-1,7-dien-2-yl]amino]pentanoic acid |
|---|---|
| PubChem CID | 89219295 |
| Molecular Formula | C31H40FN5O4 |
| Molecular Weight | 565.69 g/mol |
| Exact Mass | 565.31 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[(4R,6R,7E)-8-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-4,6-dihydroxyocta-1,7-dien-2-yl]amino]pentanoic acid |
| SMILES | C=C(C[C@@H](O)C[C@@H](O)/C=C/c1c(-c2ccc(F)cc2)c2ccccc2n1C(C)C)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C31H40FN5O4/c1-19(2)37-27-9-5-4-7-25(27)29(21-10-12-22(32)13-11-21)28(37)15-14-23(38)18-24(39)17-20(3)36-26(30(40)41)8-6-16-35-31(33)34/h4-5,7,9-15,19,23-24,26,36,38-39H,3,6,8,16-18H2,1-2H3,(H,40,41)(H4,33,34,35)/b15-14+/t23-,24+,26-/m0/s1 |
| InChIKey | CXPFFKFZOYWXFB-KLXYYMTASA-N |
| XLogP | 4.15 |
| TPSA | 159.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.69 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|