C26H34FNO5 — CID 91595621
(E,3R,5S)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enal;methanol (PubChem CID 91595621) has the molecular formula C26H34FNO5 and a molecular weight of 459.56 g/mol. Its IUPAC name is (E,3R,5S)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enal;methanol.
| Compound Name | (E,3R,5S)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enal;methanol |
|---|---|
| PubChem CID | 91595621 |
| Molecular Formula | C26H34FNO5 |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | (E,3R,5S)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enal;methanol |
| SMILES | CC(C)n1c(/C=C/[C@@H](O)C[C@@H](O)CC=O)c(-c2ccc(F)cc2)c2ccccc21.CO.CO |
| InChI | InChI=1S/C24H26FNO3.2CH4O/c1-16(2)26-22-6-4-3-5-21(22)24(17-7-9-18(25)10-8-17)23(26)12-11-19(28)15-20(29)13-14-27;2*1-2/h3-12,14,16,19-20,28-29H,13,15H2,1-2H3;2*2H,1H3/b12-11+;;/t19-,20+;;/m1../s1 |
| InChIKey | BUEJXBQPQQVKQK-ATEBZAQISA-N |
| XLogP | 3.96 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|