C25H30FNO7S — CID 175141944
(E)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoic acid;methanesulfonic acid (PubChem CID 175141944) has the molecular formula C25H30FNO7S and a molecular weight of 507.58 g/mol. Its IUPAC name is (E)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoic acid;methanesulfonic acid.
| Compound Name | (E)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoic acid;methanesulfonic acid |
|---|---|
| PubChem CID | 175141944 |
| Molecular Formula | C25H30FNO7S |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | (E)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoic acid;methanesulfonic acid |
| SMILES | CC(C)n1c(/C=C/C(O)CC(O)CC(=O)O)c(-c2ccc(F)cc2)c2ccccc21.CS(=O)(=O)O |
| InChI | InChI=1S/C24H26FNO4.CH4O3S/c1-15(2)26-21-6-4-3-5-20(21)24(16-7-9-17(25)10-8-16)22(26)12-11-18(27)13-19(28)14-23(29)30;1-5(2,3)4/h3-12,15,18-19,27-28H,13-14H2,1-2H3,(H,29,30);1H3,(H,2,3,4)/b12-11+; |
| InChIKey | ZAARVEIUHNIKMY-CALJPSDSSA-N |
| XLogP | 4.13 |
| TPSA | 137.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|