About (E,6S)-8-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-6-hydroxyoct-7-ene-2,4-dione
(E,6S)-8-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-6-hydroxyoct-7-ene-2,4-dione (PubChem CID 58850460) has the molecular formula C25H26FNO3
and a molecular weight of 407.49 g/mol. Its IUPAC name is (E,6S)-8-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-6-hydroxyoct-7-ene-2,4-dione.
Molecular Properties
| Compound Name | (E,6S)-8-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-6-hydroxyoct-7-ene-2,4-dione |
| PubChem CID | 58850460 |
| Molecular Formula | C25H26FNO3 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | (E,6S)-8-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-6-hydroxyoct-7-ene-2,4-dione |
| SMILES | CC(=O)CC(=O)C[C@H](O)/C=C/c1c(-c2ccc(F)cc2)c2ccccc2n1C(C)C |
| InChI | InChI=1S/C25H26FNO3/c1-16(2)27-23-7-5-4-6-22(23)25(18-8-10-19(26)11-9-18)24(27)13-12-20(29)15-21(30)14-17(3)28/h4-13,16,20,29H,14-15H2,1-3H3/b13-12+/t20-/m1/s1 |
| InChIKey | FACBKENOEKESPG-DRUFCSCSSA-N |
| XLogP | 5.34 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (E,6S)-8-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-6-hydroxyoct-7-ene-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,6S)-8-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-6-hydroxyoct-7-ene-2,4-dione?
The IUPAC name of (E,6S)-8-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-6-hydroxyoct-7-ene-2,4-dione (CID 58850460) is (E,6S)-8-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-6-hydroxyoct-7-ene-2,4-dione.
What is the SMILES notation for (E,6S)-8-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-6-hydroxyoct-7-ene-2,4-dione?
The canonical SMILES for (E,6S)-8-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-6-hydroxyoct-7-ene-2,4-dione is CC(=O)CC(=O)C[C@H](O)/C=C/c1c(-c2ccc(F)cc2)c2ccccc2n1C(C)C.
What is the InChIKey of (E,6S)-8-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-6-hydroxyoct-7-ene-2,4-dione?
The InChIKey is FACBKENOEKESPG-DRUFCSCSSA-N. The full InChI is InChI=1S/C25H26FNO3/c1-16(2)27-23-7-5-4-6-22(23)25(18-8-10-19(26)11-9-18)24(27)13-12-20(29)15-21(30)14-17(3)28/h4-13,16,20,29H,14-15H2,1-3H3/b13-12+/t20-/m1/s1.
What are the key properties of (E,6S)-8-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-6-hydroxyoct-7-ene-2,4-dione?
(E,6S)-8-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-6-hydroxyoct-7-ene-2,4-dione has a molecular weight of 407.49 g/mol, XLogP of 5.34, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E,6S)-8-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-6-hydroxyoct-7-ene-2,4-dione is sourced from PubChem (CID 58850460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).