C24H29FNO8P — CID 75202663
(E,3R,5S)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoic acid;phosphoric acid (PubChem CID 75202663) has the molecular formula C24H29FNO8P and a molecular weight of 509.47 g/mol. Its IUPAC name is (E,3R,5S)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoic acid;phosphoric acid.
| Compound Name | (E,3R,5S)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoic acid;phosphoric acid |
|---|---|
| PubChem CID | 75202663 |
| Molecular Formula | C24H29FNO8P |
| Molecular Weight | 509.47 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | (E,3R,5S)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoic acid;phosphoric acid |
| SMILES | CC(C)n1c(/C=C/[C@@H](O)C[C@@H](O)CC(=O)O)c(-c2ccc(F)cc2)c2ccccc21.O=P(O)(O)O |
| InChI | InChI=1S/C24H26FNO4.H3O4P/c1-15(2)26-21-6-4-3-5-20(21)24(16-7-9-17(25)10-8-16)22(26)12-11-18(27)13-19(28)14-23(29)30;1-5(2,3)4/h3-12,15,18-19,27-28H,13-14H2,1-2H3,(H,29,30);(H3,1,2,3,4)/b12-11+;/t18-,19-;/m1./s1 |
| InChIKey | GTYAJIGHVZVMEY-NRFPMOEYSA-N |
| XLogP | 3.70 |
| TPSA | 160.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|