C10H17F3N4O5 — CID 175772240
(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 175772240) has the molecular formula C10H17F3N4O5 and a molecular weight of 330.26 g/mol. Its IUPAC name is (2S)-2-acetamido-5-(diaminomethylideneamino)pentanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-acetamido-5-(diaminomethylideneamino)pentanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175772240 |
| Molecular Formula | C10H17F3N4O5 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (2S)-2-acetamido-5-(diaminomethylideneamino)pentanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)N[C@@H](CCCN=C(N)N)C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C8H16N4O3.C2HF3O2/c1-5(13)12-6(7(14)15)3-2-4-11-8(9)10;3-2(4,5)1(6)7/h6H,2-4H2,1H3,(H,12,13)(H,14,15)(H4,9,10,11);(H,6,7)/t6-;/m0./s1 |
| InChIKey | GBAJUGDZUHVSEC-RGMNGODLSA-N |
| XLogP | -0.74 |
| TPSA | 168.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|