C16H30N6O8S2 — CID 174450723
2-acetamido-3-[(2-acetamido-2-carboxyethyl)disulfanyl]propanoic acid;2-amino-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 174450723) has the molecular formula C16H30N6O8S2 and a molecular weight of 498.58 g/mol. Its IUPAC name is 2-acetamido-3-[(2-acetamido-2-carboxyethyl)disulfanyl]propanoic acid;2-amino-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-acetamido-3-[(2-acetamido-2-carboxyethyl)disulfanyl]propanoic acid;2-amino-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 174450723 |
| Molecular Formula | C16H30N6O8S2 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 2-acetamido-3-[(2-acetamido-2-carboxyethyl)disulfanyl]propanoic acid;2-amino-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(=O)NC(CSSCC(NC(C)=O)C(=O)O)C(=O)O.NC(N)=NCCCC(N)C(=O)O |
| InChI | InChI=1S/C10H16N2O6S2.C6H14N4O2/c1-5(13)11-7(9(15)16)3-19-20-4-8(10(17)18)12-6(2)14;7-4(5(11)12)2-1-3-10-6(8)9/h7-8H,3-4H2,1-2H3,(H,11,13)(H,12,14)(H,15,16)(H,17,18);4H,1-3,7H2,(H,11,12)(H4,8,9,10) |
| InChIKey | PDPRHPIUHLVMOJ-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 260.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|