C8H16N2O5S4 — CID 170171957
CID 170171957 (PubChem CID 170171957) has the molecular formula C8H16N2O5S4 and a molecular weight of 348.49 g/mol.
| Compound Name | CID 170171957 |
|---|---|
| PubChem CID | 170171957 |
| Molecular Formula | C8H16N2O5S4 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | — |
| SMILES | CC(=O)N[C@@H](CSSC[C@H](N)C(=O)O)C(=O)O.SS |
| InChI | InChI=1S/C8H14N2O5S2.H2S2/c1-4(11)10-6(8(14)15)3-17-16-2-5(9)7(12)13;1-2/h5-6H,2-3,9H2,1H3,(H,10,11)(H,12,13)(H,14,15);1-2H/t5-,6-;/m0./s1 |
| InChIKey | NBMZXIVBDRGISH-GEMLJDPKSA-N |
| XLogP | 0.13 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|